3-aminopyrrolidine-1-sulfonyl fluoride

C4H9FN2O2S — CID 155820304

IUPAC3-aminopyrrolidine-1-sulfonyl fluoride
SMILESNC1CCN(S(=O)(=O)F)C1
InChIInChI=1S/C4H9FN2O2S/c5-10(8,9)7-2-1-4(6)3-7/h4H,1-3,6H2
InChIKeyMDDXSUKQXBGXLG-UHFFFAOYSA-N
MW168.19 g/mol
LogP-0.77
Rot. Bonds1

About 3-aminopyrrolidine-1-sulfonyl fluoride

3-aminopyrrolidine-1-sulfonyl fluoride (PubChem CID 155820304) has the molecular formula C4H9FN2O2S and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-aminopyrrolidine-1-sulfonyl fluoride.

Molecular Properties

Compound Name3-aminopyrrolidine-1-sulfonyl fluoride
PubChem CID155820304
Molecular FormulaC4H9FN2O2S
Molecular Weight168.19 g/mol
Exact Mass168.04
IUPAC Name3-aminopyrrolidine-1-sulfonyl fluoride
SMILESNC1CCN(S(=O)(=O)F)C1
InChIInChI=1S/C4H9FN2O2S/c5-10(8,9)7-2-1-4(6)3-7/h4H,1-3,6H2
InChIKeyMDDXSUKQXBGXLG-UHFFFAOYSA-N
XLogP-0.77
TPSA63.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.19
LogP ≤ 5-0.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-aminopyrrolidine-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-aminopyrrolidine-1-sulfonyl fluoride?
The IUPAC name of 3-aminopyrrolidine-1-sulfonyl fluoride (CID 155820304) is 3-aminopyrrolidine-1-sulfonyl fluoride.
What is the SMILES notation for 3-aminopyrrolidine-1-sulfonyl fluoride?
The canonical SMILES for 3-aminopyrrolidine-1-sulfonyl fluoride is NC1CCN(S(=O)(=O)F)C1.
What is the InChIKey of 3-aminopyrrolidine-1-sulfonyl fluoride?
The InChIKey is MDDXSUKQXBGXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FN2O2S/c5-10(8,9)7-2-1-4(6)3-7/h4H,1-3,6H2.
What are the key properties of 3-aminopyrrolidine-1-sulfonyl fluoride?
3-aminopyrrolidine-1-sulfonyl fluoride has a molecular weight of 168.19 g/mol, XLogP of -0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopyrrolidine-1-sulfonyl fluoride is sourced from PubChem (CID 155820304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).