cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride

C5H9FO3S — CID 155820341

IUPACcis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride
SMILESO=S(=O)(F)[C@H]1CC[C@@H](O)C1
InChIInChI=1S/C5H9FO3S/c6-10(8,9)5-2-1-4(7)3-5/h4-5,7H,1-3H2/t4-,5+/m1/s1
InChIKeyGUWJWXWWVODTRT-UHNVWZDZSA-N
MW168.19 g/mol
LogP0.20
Rot. Bonds1

About cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride

cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride (PubChem CID 155820341) has the molecular formula C5H9FO3S and a molecular weight of 168.19 g/mol. Its IUPAC name is cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride.

Molecular Properties

Compound Namecis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride
PubChem CID155820341
Molecular FormulaC5H9FO3S
Molecular Weight168.19 g/mol
Exact Mass168.03
IUPAC Namecis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride
SMILESO=S(=O)(F)[C@H]1CC[C@@H](O)C1
InChIInChI=1S/C5H9FO3S/c6-10(8,9)5-2-1-4(7)3-5/h4-5,7H,1-3H2/t4-,5+/m1/s1
InChIKeyGUWJWXWWVODTRT-UHNVWZDZSA-N
XLogP0.20
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.19
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride?
The IUPAC name of cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride (CID 155820341) is cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride.
What is the SMILES notation for cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride?
The canonical SMILES for cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride is O=S(=O)(F)[C@H]1CC[C@@H](O)C1.
What is the InChIKey of cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride?
The InChIKey is GUWJWXWWVODTRT-UHNVWZDZSA-N. The full InChI is InChI=1S/C5H9FO3S/c6-10(8,9)5-2-1-4(7)3-5/h4-5,7H,1-3H2/t4-,5+/m1/s1.
What are the key properties of cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride?
cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride has a molecular weight of 168.19 g/mol, XLogP of 0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-3-hydroxycyclopentane-1-sulfonyl fluoride is sourced from PubChem (CID 155820341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).