About 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene
2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene (PubChem CID 15582073) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene |
| PubChem CID | 15582073 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(CCC(C)(C)OO)c(C)c1 |
| InChI | InChI=1S/C14H22O2/c1-10-8-11(2)13(12(3)9-10)6-7-14(4,5)16-15/h8-9,15H,6-7H2,1-5H3 |
| InChIKey | IFGQUKXLMPYCRN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene?
The IUPAC name of 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene (CID 15582073) is 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene?
The canonical SMILES for 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene is Cc1cc(C)c(CCC(C)(C)OO)c(C)c1.
What is the InChIKey of 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene?
The InChIKey is IFGQUKXLMPYCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-10-8-11(2)13(12(3)9-10)6-7-14(4,5)16-15/h8-9,15H,6-7H2,1-5H3.
What are the key properties of 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene?
2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene has a molecular weight of 222.33 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroperoxy-3-methylbutyl)-1,3,5-trimethylbenzene is sourced from PubChem (CID 15582073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).