About 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol
6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol (PubChem CID 155820862) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol.
Molecular Properties
| Compound Name | 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol |
| PubChem CID | 155820862 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol |
| SMILES | Cc1cc(O)c2ccnn2c1C |
| InChI | InChI=1S/C9H10N2O/c1-6-5-9(12)8-3-4-10-11(8)7(6)2/h3-5,12H,1-2H3 |
| InChIKey | MPZCMUALMCQDEC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol?
The IUPAC name of 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol (CID 155820862) is 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol.
What is the SMILES notation for 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol?
The canonical SMILES for 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol is Cc1cc(O)c2ccnn2c1C.
What is the InChIKey of 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol?
The InChIKey is MPZCMUALMCQDEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-6-5-9(12)8-3-4-10-11(8)7(6)2/h3-5,12H,1-2H3.
What are the key properties of 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol?
6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol has a molecular weight of 162.19 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethylpyrazolo[1,5-a]pyridin-4-ol is sourced from PubChem (CID 155820862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).