C6H12OS — CID 155820893
[(1R,2R)-2-methoxycyclobutyl]methanethiol (PubChem CID 155820893) has the molecular formula C6H12OS and a molecular weight of 132.23 g/mol. Its IUPAC name is [(1R,2R)-2-methoxycyclobutyl]methanethiol.
| Compound Name | [(1R,2R)-2-methoxycyclobutyl]methanethiol |
|---|---|
| PubChem CID | 155820893 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | [(1R,2R)-2-methoxycyclobutyl]methanethiol |
| SMILES | CO[C@@H]1CC[C@H]1CS |
| InChI | InChI=1S/C6H12OS/c1-7-6-3-2-5(6)4-8/h5-6,8H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | JOWLLXFJSAZZKK-NTSWFWBYSA-N |
| XLogP | 1.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|