About 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride
4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride (PubChem CID 155821051) has the molecular formula C8H16Cl2N2O
and a molecular weight of 227.13 g/mol. Its IUPAC name is 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride |
| PubChem CID | 155821051 |
| Molecular Formula | C8H16Cl2N2O |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride |
| SMILES | CN(C)C1CCN(C(=O)Cl)CC1.Cl |
| InChI | InChI=1S/C8H15ClN2O.ClH/c1-10(2)7-3-5-11(6-4-7)8(9)12;/h7H,3-6H2,1-2H3;1H |
| InChIKey | HLBXADXHRQMYKI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride?
The IUPAC name of 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride (CID 155821051) is 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride.
What is the SMILES notation for 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride?
The canonical SMILES for 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride is CN(C)C1CCN(C(=O)Cl)CC1.Cl.
What is the InChIKey of 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride?
The InChIKey is HLBXADXHRQMYKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClN2O.ClH/c1-10(2)7-3-5-11(6-4-7)8(9)12;/h7H,3-6H2,1-2H3;1H.
What are the key properties of 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride?
4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride has a molecular weight of 227.13 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)piperidine-1-carbonyl chloride;hydrochloride is sourced from PubChem (CID 155821051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).