About 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride
2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride (PubChem CID 155821242) has the molecular formula C7H14ClF2NO
and a molecular weight of 201.64 g/mol. Its IUPAC name is 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride |
| PubChem CID | 155821242 |
| Molecular Formula | C7H14ClF2NO |
| Molecular Weight | 201.64 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride |
| SMILES | CC(C)(O)[C@@H]1CC(F)(F)CN1.Cl |
| InChI | InChI=1S/C7H13F2NO.ClH/c1-6(2,11)5-3-7(8,9)4-10-5;/h5,10-11H,3-4H2,1-2H3;1H/t5-;/m0./s1 |
| InChIKey | RSENNMQCDLHFQR-JEDNCBNOSA-N |
| XLogP | 1.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.64 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
The IUPAC name of 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride (CID 155821242) is 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride.
What is the SMILES notation for 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
The canonical SMILES for 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride is CC(C)(O)[C@@H]1CC(F)(F)CN1.Cl.
What is the InChIKey of 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
The InChIKey is RSENNMQCDLHFQR-JEDNCBNOSA-N. The full InChI is InChI=1S/C7H13F2NO.ClH/c1-6(2,11)5-3-7(8,9)4-10-5;/h5,10-11H,3-4H2,1-2H3;1H/t5-;/m0./s1.
What are the key properties of 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride?
2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride has a molecular weight of 201.64 g/mol, XLogP of 1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride is sourced from PubChem (CID 155821242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).