About 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride
8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride (PubChem CID 155821468) has the molecular formula C7H16Cl2N2O
and a molecular weight of 215.12 g/mol. Its IUPAC name is 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride.
Molecular Properties
| Compound Name | 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride |
| PubChem CID | 155821468 |
| Molecular Formula | C7H16Cl2N2O |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride |
| SMILES | CN1CCOC2(CNC2)C1.Cl.Cl |
| InChI | InChI=1S/C7H14N2O.2ClH/c1-9-2-3-10-7(6-9)4-8-5-7;;/h8H,2-6H2,1H3;2*1H |
| InChIKey | WAMOQMMARGTCCB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride?
The IUPAC name of 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride (CID 155821468) is 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride.
What is the SMILES notation for 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride?
The canonical SMILES for 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride is CN1CCOC2(CNC2)C1.Cl.Cl.
What is the InChIKey of 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride?
The InChIKey is WAMOQMMARGTCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.2ClH/c1-9-2-3-10-7(6-9)4-8-5-7;;/h8H,2-6H2,1H3;2*1H.
What are the key properties of 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride?
8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride has a molecular weight of 215.12 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5-oxa-2,8-diazaspiro[3.5]nonane;dihydrochloride is sourced from PubChem (CID 155821468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).