About 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid
3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid (PubChem CID 155821702) has the molecular formula C6H10F3O3P
and a molecular weight of 218.11 g/mol. Its IUPAC name is 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid.
Molecular Properties
| Compound Name | 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid |
| PubChem CID | 155821702 |
| Molecular Formula | C6H10F3O3P |
| Molecular Weight | 218.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid |
| SMILES | CP(C)(=O)C(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3O3P/c1-13(2,12)4(3-5(10)11)6(7,8)9/h4H,3H2,1-2H3,(H,10,11) |
| InChIKey | UUSFXCKHKNFNAI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.11 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid (CID 155821702) is 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid is CP(C)(=O)C(CC(=O)O)C(F)(F)F.
What is the InChIKey of 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid?
The InChIKey is UUSFXCKHKNFNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3O3P/c1-13(2,12)4(3-5(10)11)6(7,8)9/h4H,3H2,1-2H3,(H,10,11).
What are the key properties of 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid?
3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid has a molecular weight of 218.11 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dimethylphosphoryl-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 155821702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).