About (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride
(2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride (PubChem CID 155821715) has the molecular formula C6H14ClNO3S
and a molecular weight of 215.70 g/mol. Its IUPAC name is (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride |
| PubChem CID | 155821715 |
| Molecular Formula | C6H14ClNO3S |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride |
| SMILES | CC1(CN)CS(=O)(=O)CCO1.Cl |
| InChI | InChI=1S/C6H13NO3S.ClH/c1-6(4-7)5-11(8,9)3-2-10-6;/h2-5,7H2,1H3;1H |
| InChIKey | WVSSBTMRUBJAER-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride?
The IUPAC name of (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride (CID 155821715) is (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride.
What is the SMILES notation for (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride?
The canonical SMILES for (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride is CC1(CN)CS(=O)(=O)CCO1.Cl.
What is the InChIKey of (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride?
The InChIKey is WVSSBTMRUBJAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3S.ClH/c1-6(4-7)5-11(8,9)3-2-10-6;/h2-5,7H2,1H3;1H.
What are the key properties of (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride?
(2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride has a molecular weight of 215.70 g/mol, XLogP of -0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4,4-dioxo-1,4-oxathian-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 155821715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).