About 3-(2,2-diethoxyethoxy)propane-1,2-diol
3-(2,2-diethoxyethoxy)propane-1,2-diol (PubChem CID 15582204) has the molecular formula C9H20O5
and a molecular weight of 208.25 g/mol. Its IUPAC name is 3-(2,2-diethoxyethoxy)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(2,2-diethoxyethoxy)propane-1,2-diol |
| PubChem CID | 15582204 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3-(2,2-diethoxyethoxy)propane-1,2-diol |
| SMILES | CCOC(COCC(O)CO)OCC |
| InChI | InChI=1S/C9H20O5/c1-3-13-9(14-4-2)7-12-6-8(11)5-10/h8-11H,3-7H2,1-2H3 |
| InChIKey | NETDTVNWZCSLMI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-diethoxyethoxy)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-diethoxyethoxy)propane-1,2-diol?
The IUPAC name of 3-(2,2-diethoxyethoxy)propane-1,2-diol (CID 15582204) is 3-(2,2-diethoxyethoxy)propane-1,2-diol.
What is the SMILES notation for 3-(2,2-diethoxyethoxy)propane-1,2-diol?
The canonical SMILES for 3-(2,2-diethoxyethoxy)propane-1,2-diol is CCOC(COCC(O)CO)OCC.
What is the InChIKey of 3-(2,2-diethoxyethoxy)propane-1,2-diol?
The InChIKey is NETDTVNWZCSLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O5/c1-3-13-9(14-4-2)7-12-6-8(11)5-10/h8-11H,3-7H2,1-2H3.
What are the key properties of 3-(2,2-diethoxyethoxy)propane-1,2-diol?
3-(2,2-diethoxyethoxy)propane-1,2-diol has a molecular weight of 208.25 g/mol, XLogP of -0.24, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-diethoxyethoxy)propane-1,2-diol is sourced from PubChem (CID 15582204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).