About [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol
[(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol (PubChem CID 155822045) has the molecular formula C9H14F2O
and a molecular weight of 176.21 g/mol. Its IUPAC name is [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol.
Molecular Properties
| Compound Name | [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol |
| PubChem CID | 155822045 |
| Molecular Formula | C9H14F2O |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol |
| SMILES | OC[C@@H]1CCCC[C@]12CC2(F)F |
| InChI | InChI=1S/C9H14F2O/c10-9(11)6-8(9)4-2-1-3-7(8)5-12/h7,12H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | OHJWKXSNWHWPAX-YUMQZZPRSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol?
The IUPAC name of [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol (CID 155822045) is [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol.
What is the SMILES notation for [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol?
The canonical SMILES for [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol is OC[C@@H]1CCCC[C@]12CC2(F)F.
What is the InChIKey of [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol?
The InChIKey is OHJWKXSNWHWPAX-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H14F2O/c10-9(11)6-8(9)4-2-1-3-7(8)5-12/h7,12H,1-6H2/t7-,8-/m0/s1.
What are the key properties of [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol?
[(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol has a molecular weight of 176.21 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,8R)-2,2-difluorospiro[2.5]octan-8-yl]methanol is sourced from PubChem (CID 155822045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).