About 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol
3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol (PubChem CID 15582206) has the molecular formula C11H24O5
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol |
| PubChem CID | 15582206 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol |
| SMILES | CC(C)OC(COCC(O)CO)OC(C)C |
| InChI | InChI=1S/C11H24O5/c1-8(2)15-11(16-9(3)4)7-14-6-10(13)5-12/h8-13H,5-7H2,1-4H3 |
| InChIKey | YSUDJZUKELJNHQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol?
The IUPAC name of 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol (CID 15582206) is 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol.
What is the SMILES notation for 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol?
The canonical SMILES for 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol is CC(C)OC(COCC(O)CO)OC(C)C.
What is the InChIKey of 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol?
The InChIKey is YSUDJZUKELJNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O5/c1-8(2)15-11(16-9(3)4)7-14-6-10(13)5-12/h8-13H,5-7H2,1-4H3.
What are the key properties of 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol?
3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol has a molecular weight of 236.31 g/mol, XLogP of 0.53, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-di(propan-2-yloxy)ethoxy]propane-1,2-diol is sourced from PubChem (CID 15582206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).