About (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride
(1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride (PubChem CID 155822124) has the molecular formula C4H8ClN3O
and a molecular weight of 149.58 g/mol. Its IUPAC name is (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride |
| PubChem CID | 155822124 |
| Molecular Formula | C4H8ClN3O |
| Molecular Weight | 149.58 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride |
| SMILES | C[C@@H](O)c1ncn[nH]1.Cl |
| InChI | InChI=1S/C4H7N3O.ClH/c1-3(8)4-5-2-6-7-4;/h2-3,8H,1H3,(H,5,6,7);1H/t3-;/m1./s1 |
| InChIKey | SZLCHAKTKBLJGC-AENDTGMFSA-N |
| XLogP | 0.28 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.58 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride?
The IUPAC name of (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride (CID 155822124) is (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride.
What is the SMILES notation for (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride?
The canonical SMILES for (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride is C[C@@H](O)c1ncn[nH]1.Cl.
What is the InChIKey of (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride?
The InChIKey is SZLCHAKTKBLJGC-AENDTGMFSA-N. The full InChI is InChI=1S/C4H7N3O.ClH/c1-3(8)4-5-2-6-7-4;/h2-3,8H,1H3,(H,5,6,7);1H/t3-;/m1./s1.
What are the key properties of (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride?
(1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride has a molecular weight of 149.58 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride is sourced from PubChem (CID 155822124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).