About 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride
4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride (PubChem CID 155822215) has the molecular formula C8H11ClN2O2
and a molecular weight of 202.64 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride.
Analyze 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride?
The IUPAC name of 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride (CID 155822215) is 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride.
What is the SMILES notation for 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride?
The canonical SMILES for 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride is Cl.O=C(O)C1CCc2[nH]ncc2C1.
What is the InChIKey of 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride?
The InChIKey is BUCIVOHPVKBBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.ClH/c11-8(12)5-1-2-7-6(3-5)4-9-10-7;/h4-5H,1-3H2,(H,9,10)(H,11,12);1H.
What are the key properties of 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride?
4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride has a molecular weight of 202.64 g/mol, XLogP of 1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid;hydrochloride is sourced from PubChem (CID 155822215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).