About 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride
5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride (PubChem CID 155822261) has the molecular formula C8H11Cl2N
and a molecular weight of 192.09 g/mol. Its IUPAC name is 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride.
Molecular Properties
| Compound Name | 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride |
| PubChem CID | 155822261 |
| Molecular Formula | C8H11Cl2N |
| Molecular Weight | 192.09 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride |
| SMILES | Cc1cc(C)c(CCl)cn1.Cl |
| InChI | InChI=1S/C8H10ClN.ClH/c1-6-3-7(2)10-5-8(6)4-9;/h3,5H,4H2,1-2H3;1H |
| InChIKey | OPOJZEGSCPGGPQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.09 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride?
The IUPAC name of 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride (CID 155822261) is 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride.
What is the SMILES notation for 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride?
The canonical SMILES for 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride is Cc1cc(C)c(CCl)cn1.Cl.
What is the InChIKey of 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride?
The InChIKey is OPOJZEGSCPGGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN.ClH/c1-6-3-7(2)10-5-8(6)4-9;/h3,5H,4H2,1-2H3;1H.
What are the key properties of 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride?
5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride has a molecular weight of 192.09 g/mol, XLogP of 2.86, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-2,4-dimethylpyridine;hydrochloride is sourced from PubChem (CID 155822261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).