About 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride
1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride (PubChem CID 155822270) has the molecular formula C12H14Cl2N2S2
and a molecular weight of 321.30 g/mol. Its IUPAC name is 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride |
| PubChem CID | 155822270 |
| Molecular Formula | C12H14Cl2N2S2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride |
| SMILES | CC(N)c1nc2c(s1)CSc1ccccc1-2.Cl.Cl |
| InChI | InChI=1S/C12H12N2S2.2ClH/c1-7(13)12-14-11-8-4-2-3-5-9(8)15-6-10(11)16-12;;/h2-5,7H,6,13H2,1H3;2*1H |
| InChIKey | NPYZGTIUBLTTAE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride?
The IUPAC name of 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride (CID 155822270) is 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride.
What is the SMILES notation for 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride?
The canonical SMILES for 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride is CC(N)c1nc2c(s1)CSc1ccccc1-2.Cl.Cl.
What is the InChIKey of 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride?
The InChIKey is NPYZGTIUBLTTAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S2.2ClH/c1-7(13)12-14-11-8-4-2-3-5-9(8)15-6-10(11)16-12;;/h2-5,7H,6,13H2,1H3;2*1H.
What are the key properties of 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride?
1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride has a molecular weight of 321.30 g/mol, XLogP of 4.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4H-thiochromeno[4,3-d][1,3]thiazol-2-yl)ethanamine;dihydrochloride is sourced from PubChem (CID 155822270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).