C8H6F3NO4S — CID 155822310
5-sulfanylpyridine-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 155822310) has the molecular formula C8H6F3NO4S and a molecular weight of 269.20 g/mol. Its IUPAC name is 5-sulfanylpyridine-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-sulfanylpyridine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155822310 |
| Molecular Formula | C8H6F3NO4S |
| Molecular Weight | 269.20 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-sulfanylpyridine-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)c1ccc(S)cn1 |
| InChI | InChI=1S/C6H5NO2S.C2HF3O2/c8-6(9)5-2-1-4(10)3-7-5;3-2(4,5)1(6)7/h1-3,10H,(H,8,9);(H,6,7) |
| InChIKey | IKBOAVUQBDIIKK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.20 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|