About 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride
5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride (PubChem CID 155822341) has the molecular formula C9H20Cl2N2O
and a molecular weight of 243.18 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride.
Molecular Properties
| Compound Name | 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride |
| PubChem CID | 155822341 |
| Molecular Formula | C9H20Cl2N2O |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride |
| SMILES | COCCN1CCCC12CNC2.Cl.Cl |
| InChI | InChI=1S/C9H18N2O.2ClH/c1-12-6-5-11-4-2-3-9(11)7-10-8-9;;/h10H,2-8H2,1H3;2*1H |
| InChIKey | YMQAPPYOWZUHLQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride?
The IUPAC name of 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride (CID 155822341) is 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride.
What is the SMILES notation for 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride?
The canonical SMILES for 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride is COCCN1CCCC12CNC2.Cl.Cl.
What is the InChIKey of 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride?
The InChIKey is YMQAPPYOWZUHLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.2ClH/c1-12-6-5-11-4-2-3-9(11)7-10-8-9;;/h10H,2-8H2,1H3;2*1H.
What are the key properties of 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride?
5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride has a molecular weight of 243.18 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyethyl)-2,5-diazaspiro[3.4]octane;dihydrochloride is sourced from PubChem (CID 155822341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).