About 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride
7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride (PubChem CID 155822400) has the molecular formula C10H16Cl2N2O
and a molecular weight of 251.16 g/mol. Its IUPAC name is 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride.
Molecular Properties
| Compound Name | 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride |
| PubChem CID | 155822400 |
| Molecular Formula | C10H16Cl2N2O |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride |
| SMILES | COc1ccc2c(c1)NCCN2C.Cl.Cl |
| InChI | InChI=1S/C10H14N2O.2ClH/c1-12-6-5-11-9-7-8(13-2)3-4-10(9)12;;/h3-4,7,11H,5-6H2,1-2H3;2*1H |
| InChIKey | YEYFIDIXIVWDSW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride?
The IUPAC name of 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride (CID 155822400) is 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride.
What is the SMILES notation for 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride?
The canonical SMILES for 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride is COc1ccc2c(c1)NCCN2C.Cl.Cl.
What is the InChIKey of 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride?
The InChIKey is YEYFIDIXIVWDSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O.2ClH/c1-12-6-5-11-9-7-8(13-2)3-4-10(9)12;;/h3-4,7,11H,5-6H2,1-2H3;2*1H.
What are the key properties of 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride?
7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride has a molecular weight of 251.16 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline;dihydrochloride is sourced from PubChem (CID 155822400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).