About 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride
5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (PubChem CID 155822472) has the molecular formula C9H12ClNO2
and a molecular weight of 201.65 g/mol. Its IUPAC name is 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride.
Molecular Properties
| Compound Name | 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| PubChem CID | 155822472 |
| Molecular Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| SMILES | COc1cccc2c1NCCO2.Cl |
| InChI | InChI=1S/C9H11NO2.ClH/c1-11-7-3-2-4-8-9(7)10-5-6-12-8;/h2-4,10H,5-6H2,1H3;1H |
| InChIKey | PWMQJFBAZBTGJY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The IUPAC name of 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CID 155822472) is 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride.
What is the SMILES notation for 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The canonical SMILES for 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride is COc1cccc2c1NCCO2.Cl.
What is the InChIKey of 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
The InChIKey is PWMQJFBAZBTGJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.ClH/c1-11-7-3-2-4-8-9(7)10-5-6-12-8;/h2-4,10H,5-6H2,1H3;1H.
What are the key properties of 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride?
5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride has a molecular weight of 201.65 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride is sourced from PubChem (CID 155822472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).