C18H41N5 — CID 155822659
N'-[2-[4-(6-aminohexyl)piperazin-1-yl]ethyl]hexane-1,6-diamine (PubChem CID 155822659) has the molecular formula C18H41N5 and a molecular weight of 327.56 g/mol. Its IUPAC name is N'-[2-[4-(6-aminohexyl)piperazin-1-yl]ethyl]hexane-1,6-diamine.
| Compound Name | N'-[2-[4-(6-aminohexyl)piperazin-1-yl]ethyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 155822659 |
| Molecular Formula | C18H41N5 |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.34 |
| IUPAC Name | N'-[2-[4-(6-aminohexyl)piperazin-1-yl]ethyl]hexane-1,6-diamine |
| SMILES | NCCCCCCNCCN1CCN(CCCCCCN)CC1 |
| InChI | InChI=1S/C18H41N5/c19-9-5-1-3-7-11-21-12-14-23-17-15-22(16-18-23)13-8-4-2-6-10-20/h21H,1-20H2 |
| InChIKey | UPMKFVJOQKIMRA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|