About 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride
2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride (PubChem CID 155822751) has the molecular formula C11H14ClF2N
and a molecular weight of 233.69 g/mol. Its IUPAC name is 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride |
| PubChem CID | 155822751 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride |
| SMILES | Cl.NCC(F)(F)c1ccccc1C1CC1 |
| InChI | InChI=1S/C11H13F2N.ClH/c12-11(13,7-14)10-4-2-1-3-9(10)8-5-6-8;/h1-4,8H,5-7,14H2;1H |
| InChIKey | OIPJPYRIMVCZNM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride?
The IUPAC name of 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride (CID 155822751) is 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride.
What is the SMILES notation for 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride?
The canonical SMILES for 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride is Cl.NCC(F)(F)c1ccccc1C1CC1.
What is the InChIKey of 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride?
The InChIKey is OIPJPYRIMVCZNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N.ClH/c12-11(13,7-14)10-4-2-1-3-9(10)8-5-6-8;/h1-4,8H,5-7,14H2;1H.
What are the key properties of 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride?
2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride has a molecular weight of 233.69 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopropylphenyl)-2,2-difluoroethanamine;hydrochloride is sourced from PubChem (CID 155822751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).