methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid

C7H10F3NO4 — CID 155822948

IUPACmethyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid
SMILESCOC(=O)[C@@H]1CCN1.O=C(O)C(F)(F)F
InChIInChI=1S/C5H9NO2.C2HF3O2/c1-8-5(7)4-2-3-6-4;3-2(4,5)1(6)7/h4,6H,2-3H2,1H3;(H,6,7)/t4-;/m0./s1
InChIKeyNOGYFFLHSFFVAV-WCCKRBBISA-N
MW229.15 g/mol
LogP0.15
Rot. Bonds1

About methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid

methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 155822948) has the molecular formula C7H10F3NO4 and a molecular weight of 229.15 g/mol. Its IUPAC name is methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namemethyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid
PubChem CID155822948
Molecular FormulaC7H10F3NO4
Molecular Weight229.15 g/mol
Exact Mass229.06
IUPAC Namemethyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid
SMILESCOC(=O)[C@@H]1CCN1.O=C(O)C(F)(F)F
InChIInChI=1S/C5H9NO2.C2HF3O2/c1-8-5(7)4-2-3-6-4;3-2(4,5)1(6)7/h4,6H,2-3H2,1H3;(H,6,7)/t4-;/m0./s1
InChIKeyNOGYFFLHSFFVAV-WCCKRBBISA-N
XLogP0.15
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.15
LogP ≤ 50.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid?
The IUPAC name of methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid (CID 155822948) is methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid?
The canonical SMILES for methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid is COC(=O)[C@@H]1CCN1.O=C(O)C(F)(F)F.
What is the InChIKey of methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid?
The InChIKey is NOGYFFLHSFFVAV-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.C2HF3O2/c1-8-5(7)4-2-3-6-4;3-2(4,5)1(6)7/h4,6H,2-3H2,1H3;(H,6,7)/t4-;/m0./s1.
What are the key properties of methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid?
methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid has a molecular weight of 229.15 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-azetidine-2-carboxylate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 155822948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).