C28H33NO9 — CID 155823051
N-benzyl-1-(oxolan-2-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 155823051) has the molecular formula C28H33NO9 and a molecular weight of 527.57 g/mol. Its IUPAC name is N-benzyl-1-(oxolan-2-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N-benzyl-1-(oxolan-2-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 155823051 |
| Molecular Formula | C28H33NO9 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | N-benzyl-1-(oxolan-2-yl)-N-[(4-prop-2-ynoxyphenyl)methyl]methanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | C#CCOc1ccc(CN(Cc2ccccc2)CC2CCCO2)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H25NO2.C6H8O7/c1-2-14-24-21-12-10-20(11-13-21)17-23(18-22-9-6-15-25-22)16-19-7-4-3-5-8-19;7-3(8)1-6(13,5(11)12)2-4(9)10/h1,3-5,7-8,10-13,22H,6,9,14-18H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | GBKXNUVUYUAPDY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 153.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|