C15H24Cl2FN3O — CID 155823381
4-(2-aminoethyl)-N-(3-fluoro-4-methylphenyl)piperidine-1-carboxamide;dihydrochloride (PubChem CID 155823381) has the molecular formula C15H24Cl2FN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-(3-fluoro-4-methylphenyl)piperidine-1-carboxamide;dihydrochloride.
| Compound Name | 4-(2-aminoethyl)-N-(3-fluoro-4-methylphenyl)piperidine-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 155823381 |
| Molecular Formula | C15H24Cl2FN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-(2-aminoethyl)-N-(3-fluoro-4-methylphenyl)piperidine-1-carboxamide;dihydrochloride |
| SMILES | Cc1ccc(NC(=O)N2CCC(CCN)CC2)cc1F.Cl.Cl |
| InChI | InChI=1S/C15H22FN3O.2ClH/c1-11-2-3-13(10-14(11)16)18-15(20)19-8-5-12(4-7-17)6-9-19;;/h2-3,10,12H,4-9,17H2,1H3,(H,18,20);2*1H |
| InChIKey | YHUVNUBQXKCLNV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |