C19H22N2O2 — CID 155823409
[2-(1-methylindol-3-yl)-2-phenylethyl]azanium acetate (PubChem CID 155823409) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is [2-(1-methylindol-3-yl)-2-phenylethyl]azanium acetate.
| Compound Name | [2-(1-methylindol-3-yl)-2-phenylethyl]azanium acetate |
|---|---|
| PubChem CID | 155823409 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | [2-(1-methylindol-3-yl)-2-phenylethyl]azanium acetate |
| SMILES | CC(=O)[O-].Cn1cc(C(C[NH3+])c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H18N2.C2H4O2/c1-19-12-16(14-9-5-6-10-17(14)19)15(11-18)13-7-3-2-4-8-13;1-2(3)4/h2-10,12,15H,11,18H2,1H3;1H3,(H,3,4) |
| InChIKey | PIBRTWLHPKTASH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |