C20H26F6N4O4 — CID 155823548
(3aR,6aS)-1-(cyclopropylmethyl)-4-(5-ethylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155823548) has the molecular formula C20H26F6N4O4 and a molecular weight of 500.44 g/mol. Its IUPAC name is (3aR,6aS)-1-(cyclopropylmethyl)-4-(5-ethylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,6aS)-1-(cyclopropylmethyl)-4-(5-ethylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155823548 |
| Molecular Formula | C20H26F6N4O4 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (3aR,6aS)-1-(cyclopropylmethyl)-4-(5-ethylpyrimidin-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCc1cnc(N2CC[C@H]3[C@H]2CCN3CC2CC2)nc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4.2C2HF3O2/c1-2-12-9-17-16(18-10-12)20-8-6-14-15(20)5-7-19(14)11-13-3-4-13;2*3-2(4,5)1(6)7/h9-10,13-15H,2-8,11H2,1H3;2*(H,6,7)/t14-,15+;;/m0../s1 |
| InChIKey | BLUWERGEBRNQOD-FZMMWMHASA-N |
| XLogP | 3.37 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |