C18H26F3N3O5S — CID 155823667
N-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155823667) has the molecular formula C18H26F3N3O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155823667 |
| Molecular Formula | C18H26F3N3O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]-2-methoxyacetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N[C@@H]1CN(Cc2scnc2C)C[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O3S.C2HF3O2/c1-11-14(23-10-17-11)8-19-6-12-4-3-5-22-16(12)13(7-19)18-15(20)9-21-2;3-2(4,5)1(6)7/h10,12-13,16H,3-9H2,1-2H3,(H,18,20);(H,6,7)/t12-,13+,16-;/m0./s1 |
| InChIKey | WPXJWHFMIAKYDU-IOKUUTPKSA-N |
| XLogP | 1.83 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |