C14H19F3N2O4S — CID 155824003
(3S,3aS,7aR)-3-methoxy-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155824003) has the molecular formula C14H19F3N2O4S and a molecular weight of 368.38 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-methoxy-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,3aS,7aR)-3-methoxy-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824003 |
| Molecular Formula | C14H19F3N2O4S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (3S,3aS,7aR)-3-methoxy-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@H]1CN(Cc2nccs2)[C@@H]2CCCO[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H18N2O2S.C2HF3O2/c1-15-10-7-14(8-11-13-4-6-17-11)9-3-2-5-16-12(9)10;3-2(4,5)1(6)7/h4,6,9-10,12H,2-3,5,7-8H2,1H3;(H,6,7)/t9-,10+,12+;/m1./s1 |
| InChIKey | XWXIBUYXOQWMPW-NMMPVGNLSA-N |
| XLogP | 2.15 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |