C20H26F3N5O4S — CID 155824056
N-[2-[5-(oxan-4-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155824056) has the molecular formula C20H26F3N5O4S and a molecular weight of 489.52 g/mol. Its IUPAC name is N-[2-[5-(oxan-4-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[5-(oxan-4-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824056 |
| Molecular Formula | C20H26F3N5O4S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-[2-[5-(oxan-4-ylmethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-7-yl]ethyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCC1CN(CC2CCOCC2)Cc2ccnn21)c1cscn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N5O2S.C2HF3O2/c24-18(17-12-26-13-20-17)19-5-1-15-10-22(9-14-3-7-25-8-4-14)11-16-2-6-21-23(15)16;3-2(4,5)1(6)7/h2,6,12-15H,1,3-5,7-11H2,(H,19,24);(H,6,7) |
| InChIKey | UXTGJDSBKHMIQK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |