C22H34F3N3O4 — CID 155824123
4a-(cyclopentylmethoxymethyl)-6-[(1-methylpyrazol-4-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155824123) has the molecular formula C22H34F3N3O4 and a molecular weight of 461.53 g/mol. Its IUPAC name is 4a-(cyclopentylmethoxymethyl)-6-[(1-methylpyrazol-4-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(cyclopentylmethoxymethyl)-6-[(1-methylpyrazol-4-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824123 |
| Molecular Formula | C22H34F3N3O4 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 4a-(cyclopentylmethoxymethyl)-6-[(1-methylpyrazol-4-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CN2CCC3OCCCC3(COCC3CCCC3)C2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H33N3O2.C2HF3O2/c1-22-12-18(11-21-22)13-23-9-7-19-20(15-23,8-4-10-25-19)16-24-14-17-5-2-3-6-17;3-2(4,5)1(6)7/h11-12,17,19H,2-10,13-16H2,1H3;(H,6,7) |
| InChIKey | QWCABJWLVKJDQG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |