C21H23F3N2O6 — CID 155824159
[(4aS,7S,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155824159) has the molecular formula C21H23F3N2O6 and a molecular weight of 456.42 g/mol. Its IUPAC name is [(4aS,7S,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(4aS,7S,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824159 |
| Molecular Formula | C21H23F3N2O6 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(4aS,7S,7aR)-7-(pyridin-2-ylmethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccoc1C(=O)N1CCO[C@H]2[C@@H](OCc3ccccn3)CC[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22N2O4.C2HF3O2/c1-13-7-10-23-17(13)19(22)21-9-11-24-18-15(21)5-6-16(18)25-12-14-4-2-3-8-20-14;3-2(4,5)1(6)7/h2-4,7-8,10,15-16,18H,5-6,9,11-12H2,1H3;(H,6,7)/t15-,16-,18+;/m0./s1 |
| InChIKey | CQBPVYWTYOSSJE-IIKXTNQWSA-N |
| XLogP | 3.21 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |