C18H18F4N4O4S — CID 155824471
[(5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155824471) has the molecular formula C18H18F4N4O4S and a molecular weight of 462.43 g/mol. Its IUPAC name is [(5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824471 |
| Molecular Formula | C18H18F4N4O4S |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | [(5aR,8aS)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccsc1)N1CCO[C@@H]2CN(c3ncc(F)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C16H17FN4O2S.C2HF3O2/c17-13-5-18-16(19-6-13)21-8-12-7-20(2-3-23-14(12)9-21)15(22)11-1-4-24-10-11;3-2(4,5)1(6)7/h1,4-6,10,12,14H,2-3,7-9H2;(H,6,7)/t12-,14+;/m0./s1 |
| InChIKey | ACCPRTCQKCFPCV-DSHXVJGRSA-N |
| XLogP | 2.29 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |