C20H29F3N4O5 — CID 155824632
(4aS,7R,7aR)-4-(6-methoxypyrimidin-4-yl)-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 155824632) has the molecular formula C20H29F3N4O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-(6-methoxypyrimidin-4-yl)-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-(6-methoxypyrimidin-4-yl)-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824632 |
| Molecular Formula | C20H29F3N4O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (4aS,7R,7aR)-4-(6-methoxypyrimidin-4-yl)-7-(2-pyrrolidin-1-ylethoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2CCO[C@H]3[C@H](OCCN4CCCC4)CC[C@@H]32)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4O3.C2HF3O2/c1-23-17-12-16(19-13-20-17)22-9-11-25-18-14(22)4-5-15(18)24-10-8-21-6-2-3-7-21;3-2(4,5)1(6)7/h12-15,18H,2-11H2,1H3;(H,6,7)/t14-,15+,18+;/m0./s1 |
| InChIKey | NLUYTSZWKGYLAG-POFIYQJBSA-N |
| XLogP | 1.97 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |