C19H25F6N5O4S — CID 155824749
N,N-dimethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155824749) has the molecular formula C19H25F6N5O4S and a molecular weight of 533.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155824749 |
| Molecular Formula | C19H25F6N5O4S |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | N,N-dimethyl-2-[7-[(4-methyl-1,3-thiazol-5-yl)methyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-5-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ncsc1CN1Cc2cncn2C(CCN(C)C)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N5S.2C2HF3O2/c1-12-15(21-11-17-12)9-19-7-13(4-5-18(2)3)20-10-16-6-14(20)8-19;2*3-2(4,5)1(6)7/h6,10-11,13H,4-5,7-9H2,1-3H3;2*(H,6,7) |
| InChIKey | KHLQKSNKRQBPCG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |