C13H22F3N5O4S — CID 155824863
5-[(dimethylamino)methyl]-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155824863) has the molecular formula C13H22F3N5O4S and a molecular weight of 401.41 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(dimethylamino)methyl]-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824863 |
| Molecular Formula | C13H22F3N5O4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 5-[(dimethylamino)methyl]-N,N-dimethyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CC1CN(S(=O)(=O)N(C)C)Cc2cncn21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H21N5O2S.C2HF3O2/c1-13(2)6-11-8-15(19(17,18)14(3)4)7-10-5-12-9-16(10)11;3-2(4,5)1(6)7/h5,9,11H,6-8H2,1-4H3;(H,6,7) |
| InChIKey | HYDXPXFKIFWDAB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |