C22H31F6N3O5S — CID 155824891
5-[[(4S,5R)-2-(cyclopropylmethyl)-4-(methoxymethyl)-2,7-diazaspiro[4.4]nonan-7-yl]methyl]-4-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155824891) has the molecular formula C22H31F6N3O5S and a molecular weight of 563.56 g/mol. Its IUPAC name is 5-[[(4S,5R)-2-(cyclopropylmethyl)-4-(methoxymethyl)-2,7-diazaspiro[4.4]nonan-7-yl]methyl]-4-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-[[(4S,5R)-2-(cyclopropylmethyl)-4-(methoxymethyl)-2,7-diazaspiro[4.4]nonan-7-yl]methyl]-4-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155824891 |
| Molecular Formula | C22H31F6N3O5S |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 5-[[(4S,5R)-2-(cyclopropylmethyl)-4-(methoxymethyl)-2,7-diazaspiro[4.4]nonan-7-yl]methyl]-4-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COC[C@@H]1CN(CC2CC2)C[C@@]12CCN(Cc1scnc1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H29N3OS.2C2HF3O2/c1-14-17(23-13-19-14)9-20-6-5-18(11-20)12-21(7-15-3-4-15)8-16(18)10-22-2;2*3-2(4,5)1(6)7/h13,15-16H,3-12H2,1-2H3;2*(H,6,7)/t16-,18-;;/m0../s1 |
| InChIKey | NFJPIDKANOOJAV-RYNABIAMSA-N |
| XLogP | 3.90 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |