C15H22F3N3O5S2 — CID 155824980
N-[(4aS,8R,8aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155824980) has the molecular formula C15H22F3N3O5S2 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(4aS,8R,8aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824980 |
| Molecular Formula | C15H22F3N3O5S2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N[C@@H]1CN(Cc2nccs2)C[C@@H]2CCCO[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H21N3O3S2.C2HF3O2/c1-21(17,18)15-11-8-16(9-12-14-4-6-20-12)7-10-3-2-5-19-13(10)11;3-2(4,5)1(6)7/h4,6,10-11,13,15H,2-3,5,7-9H2,1H3;(H,6,7)/t10-,11+,13-;/m0./s1 |
| InChIKey | UNEKFCXFFUJTNF-LWEGJDAASA-N |
| XLogP | 1.30 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |