C19H21F3N4O4S — CID 155825327
2-[(2R,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155825327) has the molecular formula C19H21F3N4O4S and a molecular weight of 458.46 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2R,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825327 |
| Molecular Formula | C19H21F3N4O4S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-pyrimidin-2-yl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-(thiophen-2-ylmethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C[C@H]1C[C@H]2CN(c3ncccn3)C[C@H]2O1)NCc1cccs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N4O2S.C2HF3O2/c22-16(20-9-14-3-1-6-24-14)8-13-7-12-10-21(11-15(12)23-13)17-18-4-2-5-19-17;3-2(4,5)1(6)7/h1-6,12-13,15H,7-11H2,(H,20,22);(H,6,7)/t12-,13+,15+;/m0./s1 |
| InChIKey | COXBSIFIPUFEFI-RAFLFFCLSA-N |
| XLogP | 2.47 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |