C20H28F3N3O3S — CID 155825343
(3aR,7aR)-1-(cyclopentylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155825343) has the molecular formula C20H28F3N3O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is (3aR,7aR)-1-(cyclopentylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aR)-1-(cyclopentylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825343 |
| Molecular Formula | C20H28F3N3O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (3aR,7aR)-1-(cyclopentylmethyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)CC[C@@H]3[C@H]2CCN3CC2CCCC2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N3OS.C2HF3O2/c1-13-19-15(12-23-13)11-21-17-8-9-20(10-14-4-2-3-5-14)16(17)6-7-18(21)22;3-2(4,5)1(6)7/h12,14,16-17H,2-11H2,1H3;(H,6,7)/t16-,17-;/m1./s1 |
| InChIKey | OEUAOOZYBVHBNL-GBNZRNLASA-N |
| XLogP | 3.84 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |