C21H26F6N4O6S2 — CID 155825382
8-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825382) has the molecular formula C21H26F6N4O6S2 and a molecular weight of 608.58 g/mol. Its IUPAC name is 8-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 8-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825382 |
| Molecular Formula | C21H26F6N4O6S2 |
| Molecular Weight | 608.58 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | 8-[(2-methyl-1,3-thiazol-4-yl)methyl]-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCOCC3(C2)CN(Cc2nccs2)CCO3)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O2S2.2C2HF3O2/c1-14-19-15(10-25-14)8-20-3-5-22-13-17(11-20)12-21(4-6-23-17)9-16-18-2-7-24-16;2*3-2(4,5)1(6)7/h2,7,10H,3-6,8-9,11-13H2,1H3;2*(H,6,7) |
| InChIKey | WOPZKTPSIIZMIW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |