C21H29F6N3O6S — CID 155825549
4-(cyclopropylmethyl)-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825549) has the molecular formula C21H29F6N3O6S and a molecular weight of 565.53 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(cyclopropylmethyl)-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825549 |
| Molecular Formula | C21H29F6N3O6S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 4-(cyclopropylmethyl)-8-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCOCC3(C2)CN(CC2CC2)CCO3)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N3O2S.2C2HF3O2/c1-14-18-16(10-23-14)9-20-4-6-21-13-17(12-20)11-19(5-7-22-17)8-15-2-3-15;2*3-2(4,5)1(6)7/h10,15H,2-9,11-13H2,1H3;2*(H,6,7) |
| InChIKey | KCFQTBJJAXOIIK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |