C17H23F3N4O4 — CID 155825688
4-[[3-(methoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid (PubChem CID 155825688) has the molecular formula C17H23F3N4O4 and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-[[3-(methoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[3-(methoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825688 |
| Molecular Formula | C17H23F3N4O4 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-[[3-(methoxymethyl)-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid |
| SMILES | COCc1cnc2n1CCN(Cc1c(C)noc1C)C2C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O2.C2HF3O2/c1-10-14(12(3)21-17-10)8-18-5-6-19-13(9-20-4)7-16-15(19)11(18)2;3-2(4,5)1(6)7/h7,11H,5-6,8-9H2,1-4H3;(H,6,7) |
| InChIKey | RRACVTRNKWXCHD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |