C19H26F6N4O7 — CID 155825778
(2R,3aS,6aS)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825778) has the molecular formula C19H26F6N4O7 and a molecular weight of 536.43 g/mol. Its IUPAC name is (2R,3aS,6aS)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (2R,3aS,6aS)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825778 |
| Molecular Formula | C19H26F6N4O7 |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (2R,3aS,6aS)-N-(2-methoxyethyl)-4-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCNC(=O)[C@H]1C[C@H]2[C@H](CCN2Cc2cnn(C)c2)O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O3.2C2HF3O2/c1-18-9-11(8-17-18)10-19-5-3-13-12(19)7-14(22-13)15(20)16-4-6-21-2;2*3-2(4,5)1(6)7/h8-9,12-14H,3-7,10H2,1-2H3,(H,16,20);2*(H,6,7)/t12-,13-,14+;;/m0../s1 |
| InChIKey | VDZWRAQWCVSEGT-HTTVLNLHSA-N |
| XLogP | 1.18 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|