C25H30F6N4O5 — CID 155825919
N-[2-[(3aS,7aR)-5-(2-phenylethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155825919) has the molecular formula C25H30F6N4O5 and a molecular weight of 580.53 g/mol. Its IUPAC name is N-[2-[(3aS,7aR)-5-(2-phenylethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[2-[(3aS,7aR)-5-(2-phenylethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155825919 |
| Molecular Formula | C25H30F6N4O5 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | N-[2-[(3aS,7aR)-5-(2-phenylethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(CCN2CC[C@H]3OCC[C@@]3(CCNc3ncccn3)C2)cc1 |
| InChI | InChI=1S/C21H28N4O.2C2HF3O2/c1-2-5-18(6-3-1)7-14-25-15-8-19-21(17-25,10-16-26-19)9-13-24-20-22-11-4-12-23-20;2*3-2(4,5)1(6)7/h1-6,11-12,19H,7-10,13-17H2,(H,22,23,24);2*(H,6,7)/t19-,21+;;/m1../s1 |
| InChIKey | YKDPWROZXYQZKJ-NPGCWXMXSA-N |
| XLogP | 4.27 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |