C21H22F3N3O3S2 — CID 155826011
1'-[(5-methylthiophen-2-yl)methyl]-3-thiophen-2-ylspiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid (PubChem CID 155826011) has the molecular formula C21H22F3N3O3S2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 1'-[(5-methylthiophen-2-yl)methyl]-3-thiophen-2-ylspiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid.
| Compound Name | 1'-[(5-methylthiophen-2-yl)methyl]-3-thiophen-2-ylspiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826011 |
| Molecular Formula | C21H22F3N3O3S2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 1'-[(5-methylthiophen-2-yl)methyl]-3-thiophen-2-ylspiro[5,8-dihydroimidazo[2,1-c][1,4]oxazine-6,3'-pyrrolidine];2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCC3(C2)Cn2c(-c4cccs4)cnc2CO3)s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N3OS2.C2HF3O2/c1-14-4-5-15(25-14)10-21-7-6-19(12-21)13-22-16(17-3-2-8-24-17)9-20-18(22)11-23-19;3-2(4,5)1(6)7/h2-5,8-9H,6-7,10-13H2,1H3;(H,6,7) |
| InChIKey | RJDYKBBUEBXFJM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |