C17H27F3N4O5S — CID 155826215
N-[[(3S,3aS,6aS)-5-[(1-ethylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155826215) has the molecular formula C17H27F3N4O5S and a molecular weight of 456.49 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-[(1-ethylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-[(1-ethylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826215 |
| Molecular Formula | C17H27F3N4O5S |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-[(1-ethylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCn1cc(CN2C[C@@H]3[C@@H](CNS(=O)(=O)CC)CO[C@@H]3C2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H26N4O3S.C2HF3O2/c1-3-19-8-12(5-16-19)7-18-9-14-13(11-22-15(14)10-18)6-17-23(20,21)4-2;3-2(4,5)1(6)7/h5,8,13-15,17H,3-4,6-7,9-11H2,1-2H3;(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | NLNDZTPTYYKYMB-ONAKXNSWSA-N |
| XLogP | 0.92 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |