C18H22F3N5O4 — CID 155826380
2-methoxy-1-[3-[(pyridin-2-ylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155826380) has the molecular formula C18H22F3N5O4 and a molecular weight of 429.40 g/mol. Its IUPAC name is 2-methoxy-1-[3-[(pyridin-2-ylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methoxy-1-[3-[(pyridin-2-ylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826380 |
| Molecular Formula | C18H22F3N5O4 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-methoxy-1-[3-[(pyridin-2-ylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-7-yl]ethanone;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)N1CCc2ncc(CNc3ccccn3)n2CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N5O2.C2HF3O2/c1-23-12-16(22)20-7-5-15-19-11-13(21(15)9-8-20)10-18-14-4-2-3-6-17-14;3-2(4,5)1(6)7/h2-4,6,11H,5,7-10,12H2,1H3,(H,17,18);(H,6,7) |
| InChIKey | IMUNFGAYLSKSCG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |