C19H25F3N6O4 — CID 155826426
1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826426) has the molecular formula C19H25F3N6O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is 1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826426 |
| Molecular Formula | C19H25F3N6O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1-methyl-N-[[7-(oxolan-3-yl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]pyrazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(C(=O)NCc2cnc3n2CCN(C2CCOC2)CC3)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N6O2.C2HF3O2/c1-21-11-13(8-20-21)17(24)19-10-15-9-18-16-2-4-22(5-6-23(15)16)14-3-7-25-12-14;3-2(4,5)1(6)7/h8-9,11,14H,2-7,10,12H2,1H3,(H,19,24);(H,6,7) |
| InChIKey | RTEUPRIOZIBCAI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |